C8H13IN4 — CID 116649653
3-N-(5-iodopyrimidin-2-yl)butane-1,3-diamine (PubChem CID 116649653) has the molecular formula C8H13IN4 and a molecular weight of 292.12 g/mol. Its IUPAC name is 3-N-(5-iodopyrimidin-2-yl)butane-1,3-diamine.
| Compound Name | 3-N-(5-iodopyrimidin-2-yl)butane-1,3-diamine |
|---|---|
| PubChem CID | 116649653 |
| Molecular Formula | C8H13IN4 |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 3-N-(5-iodopyrimidin-2-yl)butane-1,3-diamine |
| SMILES | CC(CCN)Nc1ncc(I)cn1 |
| InChI | InChI=1S/C8H13IN4/c1-6(2-3-10)13-8-11-4-7(9)5-12-8/h4-6H,2-3,10H2,1H3,(H,11,12,13) |
| InChIKey | GSQLUPQLLDXQLR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|