C12H21N3O — CID 103858207
4,4-dimethyl-3-[(5-methylpyrimidin-2-yl)amino]pentan-1-ol (PubChem CID 103858207) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 4,4-dimethyl-3-[(5-methylpyrimidin-2-yl)amino]pentan-1-ol.
| Compound Name | 4,4-dimethyl-3-[(5-methylpyrimidin-2-yl)amino]pentan-1-ol |
|---|---|
| PubChem CID | 103858207 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 4,4-dimethyl-3-[(5-methylpyrimidin-2-yl)amino]pentan-1-ol |
| SMILES | Cc1cnc(NC(CCO)C(C)(C)C)nc1 |
| InChI | InChI=1S/C12H21N3O/c1-9-7-13-11(14-8-9)15-10(5-6-16)12(2,3)4/h7-8,10,16H,5-6H2,1-4H3,(H,13,14,15) |
| InChIKey | RNXMAMMAGONOJN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |