C13H18BrClN2O — CID 106355742
5-bromo-N-(1-chloro-4,4-dimethylpentan-3-yl)pyridine-3-carboxamide (PubChem CID 106355742) has the molecular formula C13H18BrClN2O and a molecular weight of 333.66 g/mol. Its IUPAC name is 5-bromo-N-(1-chloro-4,4-dimethylpentan-3-yl)pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-(1-chloro-4,4-dimethylpentan-3-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 106355742 |
| Molecular Formula | C13H18BrClN2O |
| Molecular Weight | 333.66 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 5-bromo-N-(1-chloro-4,4-dimethylpentan-3-yl)pyridine-3-carboxamide |
| SMILES | CC(C)(C)C(CCCl)NC(=O)c1cncc(Br)c1 |
| InChI | InChI=1S/C13H18BrClN2O/c1-13(2,3)11(4-5-15)17-12(18)9-6-10(14)8-16-7-9/h6-8,11H,4-5H2,1-3H3,(H,17,18) |
| InChIKey | AWYLWTVBXXIMIV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.66 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|