C13H23Cl2N3 — CID 106354133
1-chloro-N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-4,4-dimethylpentan-3-amine (PubChem CID 106354133) has the molecular formula C13H23Cl2N3 and a molecular weight of 292.25 g/mol. Its IUPAC name is 1-chloro-N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-4,4-dimethylpentan-3-amine.
| Compound Name | 1-chloro-N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-4,4-dimethylpentan-3-amine |
|---|---|
| PubChem CID | 106354133 |
| Molecular Formula | C13H23Cl2N3 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 1-chloro-N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-4,4-dimethylpentan-3-amine |
| SMILES | Cc1nn(C)c(Cl)c1CNC(CCCl)C(C)(C)C |
| InChI | InChI=1S/C13H23Cl2N3/c1-9-10(12(15)18(5)17-9)8-16-11(6-7-14)13(2,3)4/h11,16H,6-8H2,1-5H3 |
| InChIKey | YBANDZLTOGMZHO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|