About 1-chloro-2-methyl-N-[(2,4,6-trimethylphenyl)methyl]butan-2-amine
1-chloro-2-methyl-N-[(2,4,6-trimethylphenyl)methyl]butan-2-amine (PubChem CID 65025267) has the molecular formula C15H24ClN
and a molecular weight of 253.82 g/mol. Its IUPAC name is 1-chloro-2-methyl-N-[(2,4,6-trimethylphenyl)methyl]butan-2-amine.
Molecular Properties
| Compound Name | 1-chloro-2-methyl-N-[(2,4,6-trimethylphenyl)methyl]butan-2-amine |
| PubChem CID | 65025267 |
| Molecular Formula | C15H24ClN |
| Molecular Weight | 253.82 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 1-chloro-2-methyl-N-[(2,4,6-trimethylphenyl)methyl]butan-2-amine |
| SMILES | CCC(C)(CCl)NCc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C15H24ClN/c1-6-15(5,10-16)17-9-14-12(3)7-11(2)8-13(14)4/h7-8,17H,6,9-10H2,1-5H3 |
| InChIKey | OKZZXSPYVYAGSV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.82 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2-methyl-N-[(2,4,6-trimethylphenyl)methyl]butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-methyl-N-[(2,4,6-trimethylphenyl)methyl]butan-2-amine?
The IUPAC name of 1-chloro-2-methyl-N-[(2,4,6-trimethylphenyl)methyl]butan-2-amine (CID 65025267) is 1-chloro-2-methyl-N-[(2,4,6-trimethylphenyl)methyl]butan-2-amine.
What is the SMILES notation for 1-chloro-2-methyl-N-[(2,4,6-trimethylphenyl)methyl]butan-2-amine?
The canonical SMILES for 1-chloro-2-methyl-N-[(2,4,6-trimethylphenyl)methyl]butan-2-amine is CCC(C)(CCl)NCc1c(C)cc(C)cc1C.
What is the InChIKey of 1-chloro-2-methyl-N-[(2,4,6-trimethylphenyl)methyl]butan-2-amine?
The InChIKey is OKZZXSPYVYAGSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24ClN/c1-6-15(5,10-16)17-9-14-12(3)7-11(2)8-13(14)4/h7-8,17H,6,9-10H2,1-5H3.
What are the key properties of 1-chloro-2-methyl-N-[(2,4,6-trimethylphenyl)methyl]butan-2-amine?
1-chloro-2-methyl-N-[(2,4,6-trimethylphenyl)methyl]butan-2-amine has a molecular weight of 253.82 g/mol, XLogP of 4.11, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-methyl-N-[(2,4,6-trimethylphenyl)methyl]butan-2-amine is sourced from PubChem (CID 65025267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).