C15H24ClN — CID 65025267
1-chloro-2-methyl-N-[(2,4,6-trimethylphenyl)methyl]butan-2-amine (PubChem CID 65025267) has the molecular formula C15H24ClN and a molecular weight of 253.82 g/mol. Its IUPAC name is 1-chloro-2-methyl-N-[(2,4,6-trimethylphenyl)methyl]butan-2-amine.
| Compound Name | 1-chloro-2-methyl-N-[(2,4,6-trimethylphenyl)methyl]butan-2-amine |
|---|---|
| PubChem CID | 65025267 |
| Molecular Formula | C15H24ClN |
| Molecular Weight | 253.82 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 1-chloro-2-methyl-N-[(2,4,6-trimethylphenyl)methyl]butan-2-amine |
| SMILES | CCC(C)(CCl)NCc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C15H24ClN/c1-6-15(5,10-16)17-9-14-12(3)7-11(2)8-13(14)4/h7-8,17H,6,9-10H2,1-5H3 |
| InChIKey | OKZZXSPYVYAGSV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.82 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|