C21H26NO2P — CID 11862716
N-[(S)-[3,3-dimethylbut-1-ynyl(ethoxy)phosphoryl]-phenylmethyl]aniline (PubChem CID 11862716) has the molecular formula C21H26NO2P and a molecular weight of 355.42 g/mol. Its IUPAC name is N-[(S)-[3,3-dimethylbut-1-ynyl(ethoxy)phosphoryl]-phenylmethyl]aniline.
| Compound Name | N-[(S)-[3,3-dimethylbut-1-ynyl(ethoxy)phosphoryl]-phenylmethyl]aniline |
|---|---|
| PubChem CID | 11862716 |
| Molecular Formula | C21H26NO2P |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | N-[(S)-[3,3-dimethylbut-1-ynyl(ethoxy)phosphoryl]-phenylmethyl]aniline |
| SMILES | CCO[P@](=O)(C#CC(C)(C)C)[C@H](Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H26NO2P/c1-5-24-25(23,17-16-21(2,3)4)20(18-12-8-6-9-13-18)22-19-14-10-7-11-15-19/h6-15,20,22H,5H2,1-4H3/t20-,25+/m0/s1 |
| InChIKey | QKBFVPZBQBAFCQ-NBGIEHNGSA-N |
| XLogP | 6.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|