C22H27BrNO2P — CID 27279104
(1R)-N-benzyl-1-(4-bromophenyl)-1-[3,3-dimethylbut-1-ynyl(ethoxy)phosphoryl]methanamine (PubChem CID 27279104) has the molecular formula C22H27BrNO2P and a molecular weight of 448.34 g/mol. Its IUPAC name is (1R)-N-benzyl-1-(4-bromophenyl)-1-[3,3-dimethylbut-1-ynyl(ethoxy)phosphoryl]methanamine.
| Compound Name | (1R)-N-benzyl-1-(4-bromophenyl)-1-[3,3-dimethylbut-1-ynyl(ethoxy)phosphoryl]methanamine |
|---|---|
| PubChem CID | 27279104 |
| Molecular Formula | C22H27BrNO2P |
| Molecular Weight | 448.34 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | (1R)-N-benzyl-1-(4-bromophenyl)-1-[3,3-dimethylbut-1-ynyl(ethoxy)phosphoryl]methanamine |
| SMILES | CCO[P@@](=O)(C#CC(C)(C)C)[C@@H](NCc1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H27BrNO2P/c1-5-26-27(25,16-15-22(2,3)4)21(19-11-13-20(23)14-12-19)24-17-18-9-7-6-8-10-18/h6-14,21,24H,5,17H2,1-4H3/t21-,27+/m1/s1 |
| InChIKey | PUUDWNUNBVTUBV-ZBLYBZFDSA-N |
| XLogP | 6.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.34 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|