C16H22ClO3P — CID 11862945
(1S)-2-chloro-1-[3,3-dimethylbut-1-ynyl(ethoxy)phosphoryl]-1-phenylethanol (PubChem CID 11862945) has the molecular formula C16H22ClO3P and a molecular weight of 328.78 g/mol. Its IUPAC name is (1S)-2-chloro-1-[3,3-dimethylbut-1-ynyl(ethoxy)phosphoryl]-1-phenylethanol.
| Compound Name | (1S)-2-chloro-1-[3,3-dimethylbut-1-ynyl(ethoxy)phosphoryl]-1-phenylethanol |
|---|---|
| PubChem CID | 11862945 |
| Molecular Formula | C16H22ClO3P |
| Molecular Weight | 328.78 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | (1S)-2-chloro-1-[3,3-dimethylbut-1-ynyl(ethoxy)phosphoryl]-1-phenylethanol |
| SMILES | CCO[P@](=O)(C#CC(C)(C)C)[C@](O)(CCl)c1ccccc1 |
| InChI | InChI=1S/C16H22ClO3P/c1-5-20-21(19,12-11-15(2,3)4)16(18,13-17)14-9-7-6-8-10-14/h6-10,18H,5,13H2,1-4H3/t16-,21-/m1/s1 |
| InChIKey | IWNCGMNEXLVFHJ-IIBYNOLFSA-N |
| XLogP | 4.39 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.78 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|