C16H28O7P2 — CID 10340585
1,1-bis(diethoxyphosphoryl)-2-phenylethanol (PubChem CID 10340585) has the molecular formula C16H28O7P2 and a molecular weight of 394.34 g/mol. Its IUPAC name is 1,1-bis(diethoxyphosphoryl)-2-phenylethanol.
| Compound Name | 1,1-bis(diethoxyphosphoryl)-2-phenylethanol |
|---|---|
| PubChem CID | 10340585 |
| Molecular Formula | C16H28O7P2 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 1,1-bis(diethoxyphosphoryl)-2-phenylethanol |
| SMILES | CCOP(=O)(OCC)C(O)(Cc1ccccc1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C16H28O7P2/c1-5-20-24(18,21-6-2)16(17,14-15-12-10-9-11-13-15)25(19,22-7-3)23-8-4/h9-13,17H,5-8,14H2,1-4H3 |
| InChIKey | FKCGHGOXUVEXBO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|