C20H25O4PSe — CID 101257767
2-diethoxyphosphorylselanyl-2-methyl-1,3-diphenylpropan-1-one (PubChem CID 101257767) has the molecular formula C20H25O4PSe and a molecular weight of 439.35 g/mol. Its IUPAC name is 2-diethoxyphosphorylselanyl-2-methyl-1,3-diphenylpropan-1-one.
| Compound Name | 2-diethoxyphosphorylselanyl-2-methyl-1,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 101257767 |
| Molecular Formula | C20H25O4PSe |
| Molecular Weight | 439.35 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | 2-diethoxyphosphorylselanyl-2-methyl-1,3-diphenylpropan-1-one |
| SMILES | CCOP(=O)(OCC)[Se]C(C)(Cc1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H25O4PSe/c1-4-23-25(22,24-5-2)26-20(3,16-17-12-8-6-9-13-17)19(21)18-14-10-7-11-15-18/h6-15H,4-5,16H2,1-3H3 |
| InChIKey | IGRFJXBDZKSAAZ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.35 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|