C22H29O4PS — CID 11223893
2-di(propan-2-yloxy)phosphorylsulfanyl-2-methyl-1,3-diphenylpropan-1-one (PubChem CID 11223893) has the molecular formula C22H29O4PS and a molecular weight of 420.51 g/mol. Its IUPAC name is 2-di(propan-2-yloxy)phosphorylsulfanyl-2-methyl-1,3-diphenylpropan-1-one.
| Compound Name | 2-di(propan-2-yloxy)phosphorylsulfanyl-2-methyl-1,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 11223893 |
| Molecular Formula | C22H29O4PS |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 2-di(propan-2-yloxy)phosphorylsulfanyl-2-methyl-1,3-diphenylpropan-1-one |
| SMILES | CC(C)OP(=O)(OC(C)C)SC(C)(Cc1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H29O4PS/c1-17(2)25-27(24,26-18(3)4)28-22(5,16-19-12-8-6-9-13-19)21(23)20-14-10-7-11-15-20/h6-15,17-18H,16H2,1-5H3 |
| InChIKey | FVZIRAKPRKTEQJ-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|