C12H17Cl2O3P — CID 11141450
(2,2-dichloro-2-diethoxyphosphorylethyl)benzene (PubChem CID 11141450) has the molecular formula C12H17Cl2O3P and a molecular weight of 311.15 g/mol. Its IUPAC name is (2,2-dichloro-2-diethoxyphosphorylethyl)benzene.
| Compound Name | (2,2-dichloro-2-diethoxyphosphorylethyl)benzene |
|---|---|
| PubChem CID | 11141450 |
| Molecular Formula | C12H17Cl2O3P |
| Molecular Weight | 311.15 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | (2,2-dichloro-2-diethoxyphosphorylethyl)benzene |
| SMILES | CCOP(=O)(OCC)C(Cl)(Cl)Cc1ccccc1 |
| InChI | InChI=1S/C12H17Cl2O3P/c1-3-16-18(15,17-4-2)12(13,14)10-11-8-6-5-7-9-11/h5-9H,3-4,10H2,1-2H3 |
| InChIKey | AQUZQXGZTXZCKH-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.15 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|