C10H12Cl3O3P — CID 46220815
2,2,2-trichloro-1-[ethoxy(phenyl)phosphoryl]ethanol (PubChem CID 46220815) has the molecular formula C10H12Cl3O3P and a molecular weight of 317.54 g/mol. Its IUPAC name is 2,2,2-trichloro-1-[ethoxy(phenyl)phosphoryl]ethanol.
| Compound Name | 2,2,2-trichloro-1-[ethoxy(phenyl)phosphoryl]ethanol |
|---|---|
| PubChem CID | 46220815 |
| Molecular Formula | C10H12Cl3O3P |
| Molecular Weight | 317.54 g/mol |
| Exact Mass | 315.96 |
| IUPAC Name | 2,2,2-trichloro-1-[ethoxy(phenyl)phosphoryl]ethanol |
| SMILES | CCOP(=O)(c1ccccc1)C(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H12Cl3O3P/c1-2-16-17(15,9(14)10(11,12)13)8-6-4-3-5-7-8/h3-7,9,14H,2H2,1H3 |
| InChIKey | MXICENIPTONBED-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|