C14H19O5P — CID 45113420
(3R)-3-[(S)-[ethoxy(phenyl)phosphoryl]-hydroxymethyl]oxan-4-one (PubChem CID 45113420) has the molecular formula C14H19O5P and a molecular weight of 298.27 g/mol. Its IUPAC name is (3R)-3-[(S)-[ethoxy(phenyl)phosphoryl]-hydroxymethyl]oxan-4-one.
| Compound Name | (3R)-3-[(S)-[ethoxy(phenyl)phosphoryl]-hydroxymethyl]oxan-4-one |
|---|---|
| PubChem CID | 45113420 |
| Molecular Formula | C14H19O5P |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | (3R)-3-[(S)-[ethoxy(phenyl)phosphoryl]-hydroxymethyl]oxan-4-one |
| SMILES | CCO[P@@](=O)(c1ccccc1)[C@H](O)[C@@H]1COCCC1=O |
| InChI | InChI=1S/C14H19O5P/c1-2-19-20(17,11-6-4-3-5-7-11)14(16)12-10-18-9-8-13(12)15/h3-7,12,14,16H,2,8-10H2,1H3/t12-,14+,20+/m1/s1 |
| InChIKey | IJCXZCOPNRQMFF-VQZRKKFQSA-N |
| XLogP | 1.55 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|