C30H37N2O6P — CID 56993590
N-[[[benzamido-(2-oxocyclohexyl)methyl]-ethoxyphosphoryl]-(2-oxocyclohexyl)methyl]benzamide (PubChem CID 56993590) has the molecular formula C30H37N2O6P and a molecular weight of 552.61 g/mol. Its IUPAC name is N-[[[benzamido-(2-oxocyclohexyl)methyl]-ethoxyphosphoryl]-(2-oxocyclohexyl)methyl]benzamide.
| Compound Name | N-[[[benzamido-(2-oxocyclohexyl)methyl]-ethoxyphosphoryl]-(2-oxocyclohexyl)methyl]benzamide |
|---|---|
| PubChem CID | 56993590 |
| Molecular Formula | C30H37N2O6P |
| Molecular Weight | 552.61 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | N-[[[benzamido-(2-oxocyclohexyl)methyl]-ethoxyphosphoryl]-(2-oxocyclohexyl)methyl]benzamide |
| SMILES | CCOP(=O)(C(NC(=O)c1ccccc1)C1CCCCC1=O)C(NC(=O)c1ccccc1)C1CCCCC1=O |
| InChI | InChI=1S/C30H37N2O6P/c1-2-38-39(37,29(23-17-9-11-19-25(23)33)31-27(35)21-13-5-3-6-14-21)30(24-18-10-12-20-26(24)34)32-28(36)22-15-7-4-8-16-22/h3-8,13-16,23-24,29-30H,2,9-12,17-20H2,1H3,(H,31,35)(H,32,36) |
| InChIKey | RMKXXDKJGDFGLP-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.61 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|