C17H21NO5 — CID 162397266
ethyl 2-(2-oxocyclopentyl)-2-(phenylmethoxycarbonylamino)acetate (PubChem CID 162397266) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is ethyl 2-(2-oxocyclopentyl)-2-(phenylmethoxycarbonylamino)acetate.
| Compound Name | ethyl 2-(2-oxocyclopentyl)-2-(phenylmethoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 162397266 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | ethyl 2-(2-oxocyclopentyl)-2-(phenylmethoxycarbonylamino)acetate |
| SMILES | CCOC(=O)C(NC(=O)OCc1ccccc1)C1CCCC1=O |
| InChI | InChI=1S/C17H21NO5/c1-2-22-16(20)15(13-9-6-10-14(13)19)18-17(21)23-11-12-7-4-3-5-8-12/h3-5,7-8,13,15H,2,6,9-11H2,1H3,(H,18,21) |
| InChIKey | RONZMGVVAYOVBV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |