C18H24FNO3 — CID 1481353
ethyl N-[(R)-(2-fluorophenyl)-[(1R)-2-oxocyclooctyl]methyl]carbamate (PubChem CID 1481353) has the molecular formula C18H24FNO3 and a molecular weight of 321.39 g/mol. Its IUPAC name is ethyl N-[(R)-(2-fluorophenyl)-[(1R)-2-oxocyclooctyl]methyl]carbamate.
| Compound Name | ethyl N-[(R)-(2-fluorophenyl)-[(1R)-2-oxocyclooctyl]methyl]carbamate |
|---|---|
| PubChem CID | 1481353 |
| Molecular Formula | C18H24FNO3 |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | ethyl N-[(R)-(2-fluorophenyl)-[(1R)-2-oxocyclooctyl]methyl]carbamate |
| SMILES | CCOC(=O)N[C@@H](c1ccccc1F)[C@H]1CCCCCCC1=O |
| InChI | InChI=1S/C18H24FNO3/c1-2-23-18(22)20-17(13-9-7-8-11-15(13)19)14-10-5-3-4-6-12-16(14)21/h7-9,11,14,17H,2-6,10,12H2,1H3,(H,20,22)/t14-,17-/m0/s1 |
| InChIKey | VWADWCHWRONRRC-YOEHRIQHSA-N |
| XLogP | 4.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |