C16H23FN2O3 — CID 110892585
ethyl N-[1-[2-(2-fluorophenyl)-2-hydroxyethyl]piperidin-3-yl]carbamate (PubChem CID 110892585) has the molecular formula C16H23FN2O3 and a molecular weight of 310.37 g/mol. Its IUPAC name is ethyl N-[1-[2-(2-fluorophenyl)-2-hydroxyethyl]piperidin-3-yl]carbamate.
| Compound Name | ethyl N-[1-[2-(2-fluorophenyl)-2-hydroxyethyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 110892585 |
| Molecular Formula | C16H23FN2O3 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | ethyl N-[1-[2-(2-fluorophenyl)-2-hydroxyethyl]piperidin-3-yl]carbamate |
| SMILES | CCOC(=O)NC1CCCN(CC(O)c2ccccc2F)C1 |
| InChI | InChI=1S/C16H23FN2O3/c1-2-22-16(21)18-12-6-5-9-19(10-12)11-15(20)13-7-3-4-8-14(13)17/h3-4,7-8,12,15,20H,2,5-6,9-11H2,1H3,(H,18,21) |
| InChIKey | VIMLFDQAQOVFCS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |