C15H23FN2O — CID 111102980
2-(4-ethyl-1,4-diazepan-1-yl)-1-(2-fluorophenyl)ethanol (PubChem CID 111102980) has the molecular formula C15H23FN2O and a molecular weight of 266.36 g/mol. Its IUPAC name is 2-(4-ethyl-1,4-diazepan-1-yl)-1-(2-fluorophenyl)ethanol.
| Compound Name | 2-(4-ethyl-1,4-diazepan-1-yl)-1-(2-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 111102980 |
| Molecular Formula | C15H23FN2O |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 2-(4-ethyl-1,4-diazepan-1-yl)-1-(2-fluorophenyl)ethanol |
| SMILES | CCN1CCCN(CC(O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C15H23FN2O/c1-2-17-8-5-9-18(11-10-17)12-15(19)13-6-3-4-7-14(13)16/h3-4,6-7,15,19H,2,5,8-12H2,1H3 |
| InChIKey | YYBROFRYAAWITF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |