C15H21FN2O3 — CID 110887601
ethyl 4-[2-(2-fluorophenyl)-2-hydroxyethyl]piperazine-1-carboxylate (PubChem CID 110887601) has the molecular formula C15H21FN2O3 and a molecular weight of 296.34 g/mol. Its IUPAC name is ethyl 4-[2-(2-fluorophenyl)-2-hydroxyethyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-(2-fluorophenyl)-2-hydroxyethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 110887601 |
| Molecular Formula | C15H21FN2O3 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | ethyl 4-[2-(2-fluorophenyl)-2-hydroxyethyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(CC(O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C15H21FN2O3/c1-2-21-15(20)18-9-7-17(8-10-18)11-14(19)12-5-3-4-6-13(12)16/h3-6,14,19H,2,7-11H2,1H3 |
| InChIKey | CBDBTVVPNSXHFY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |