C10H12FNO — CID 82125307
2-(aziridin-1-yl)-1-(2-fluorophenyl)ethanol (PubChem CID 82125307) has the molecular formula C10H12FNO and a molecular weight of 181.21 g/mol. Its IUPAC name is 2-(aziridin-1-yl)-1-(2-fluorophenyl)ethanol.
| Compound Name | 2-(aziridin-1-yl)-1-(2-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 82125307 |
| Molecular Formula | C10H12FNO |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 2-(aziridin-1-yl)-1-(2-fluorophenyl)ethanol |
| SMILES | OC(CN1CC1)c1ccccc1F |
| InChI | InChI=1S/C10H12FNO/c11-9-4-2-1-3-8(9)10(13)7-12-5-6-12/h1-4,10,13H,5-7H2 |
| InChIKey | CMLCWSCJYOMJRI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 23.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|