C18H21ClFN3O — CID 111421571
2-[4-[(6-chloro-3-pyridinyl)methyl]piperazin-1-yl]-1-(2-fluorophenyl)ethanol (PubChem CID 111421571) has the molecular formula C18H21ClFN3O and a molecular weight of 349.84 g/mol. Its IUPAC name is 2-[4-[(6-chloro-3-pyridinyl)methyl]piperazin-1-yl]-1-(2-fluorophenyl)ethanol.
| Compound Name | 2-[4-[(6-chloro-3-pyridinyl)methyl]piperazin-1-yl]-1-(2-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 111421571 |
| Molecular Formula | C18H21ClFN3O |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 2-[4-[(6-chloro-3-pyridinyl)methyl]piperazin-1-yl]-1-(2-fluorophenyl)ethanol |
| SMILES | OC(CN1CCN(Cc2ccc(Cl)nc2)CC1)c1ccccc1F |
| InChI | InChI=1S/C18H21ClFN3O/c19-18-6-5-14(11-21-18)12-22-7-9-23(10-8-22)13-17(24)15-3-1-2-4-16(15)20/h1-6,11,17,24H,7-10,12-13H2 |
| InChIKey | MXYAUEJISVADBI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|