C21H23ClN2OS — CID 44603504
1-(1-benzothiophen-3-yl)-2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]ethanol (PubChem CID 44603504) has the molecular formula C21H23ClN2OS and a molecular weight of 386.95 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]ethanol.
| Compound Name | 1-(1-benzothiophen-3-yl)-2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 44603504 |
| Molecular Formula | C21H23ClN2OS |
| Molecular Weight | 386.95 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]ethanol |
| SMILES | OC(CN1CCN(Cc2ccc(Cl)cc2)CC1)c1csc2ccccc12 |
| InChI | InChI=1S/C21H23ClN2OS/c22-17-7-5-16(6-8-17)13-23-9-11-24(12-10-23)14-20(25)19-15-26-21-4-2-1-3-18(19)21/h1-8,15,20,25H,9-14H2 |
| InChIKey | XFQUVOMAAQZCPY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.95 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |