C18H16ClNO3S — CID 100724869
N-[(2S)-2-(1-benzothiophen-3-yl)-2-hydroxyethyl]-2-(4-chlorophenoxy)acetamide (PubChem CID 100724869) has the molecular formula C18H16ClNO3S and a molecular weight of 361.85 g/mol. Its IUPAC name is N-[(2S)-2-(1-benzothiophen-3-yl)-2-hydroxyethyl]-2-(4-chlorophenoxy)acetamide.
| Compound Name | N-[(2S)-2-(1-benzothiophen-3-yl)-2-hydroxyethyl]-2-(4-chlorophenoxy)acetamide |
|---|---|
| PubChem CID | 100724869 |
| Molecular Formula | C18H16ClNO3S |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | N-[(2S)-2-(1-benzothiophen-3-yl)-2-hydroxyethyl]-2-(4-chlorophenoxy)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1)NC[C@@H](O)c1csc2ccccc12 |
| InChI | InChI=1S/C18H16ClNO3S/c19-12-5-7-13(8-6-12)23-10-18(22)20-9-16(21)15-11-24-17-4-2-1-3-14(15)17/h1-8,11,16,21H,9-10H2,(H,20,22)/t16-/m1/s1 |
| InChIKey | JJGHTLMUXSNSBO-MRXNPFEDSA-N |
| XLogP | 3.78 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |