C14H14ClNO4 — CID 110889268
2-(4-chlorophenoxy)-N-[2-(furan-2-yl)-2-hydroxyethyl]acetamide (PubChem CID 110889268) has the molecular formula C14H14ClNO4 and a molecular weight of 295.72 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[2-(furan-2-yl)-2-hydroxyethyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[2-(furan-2-yl)-2-hydroxyethyl]acetamide |
|---|---|
| PubChem CID | 110889268 |
| Molecular Formula | C14H14ClNO4 |
| Molecular Weight | 295.72 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[2-(furan-2-yl)-2-hydroxyethyl]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1)NCC(O)c1ccco1 |
| InChI | InChI=1S/C14H14ClNO4/c15-10-3-5-11(6-4-10)20-9-14(18)16-8-12(17)13-2-1-7-19-13/h1-7,12,17H,8-9H2,(H,16,18) |
| InChIKey | HTYKTEUQKMBLFD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.72 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |