C18H22ClN2O4+ — CID 7217183
2-(4-chlorophenoxy)-N-[(2R)-2-(furan-2-yl)-2-morpholin-4-ium-4-ylethyl]acetamide (PubChem CID 7217183) has the molecular formula C18H22ClN2O4+ and a molecular weight of 365.84 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[(2R)-2-(furan-2-yl)-2-morpholin-4-ium-4-ylethyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[(2R)-2-(furan-2-yl)-2-morpholin-4-ium-4-ylethyl]acetamide |
|---|---|
| PubChem CID | 7217183 |
| Molecular Formula | C18H22ClN2O4+ |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[(2R)-2-(furan-2-yl)-2-morpholin-4-ium-4-ylethyl]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1)NC[C@H](c1ccco1)[NH+]1CCOCC1 |
| InChI | InChI=1S/C18H21ClN2O4/c19-14-3-5-15(6-4-14)25-13-18(22)20-12-16(17-2-1-9-24-17)21-7-10-23-11-8-21/h1-6,9,16H,7-8,10-13H2,(H,20,22)/p+1/t16-/m1/s1 |
| InChIKey | ODRHHYGULSYXFT-MRXNPFEDSA-O |
| XLogP | 1.08 |
| TPSA | 65.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |