C20H27N2O3+ — CID 7972555
2-(4-ethylphenoxy)-N-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]acetamide (PubChem CID 7972555) has the molecular formula C20H27N2O3+ and a molecular weight of 343.45 g/mol. Its IUPAC name is 2-(4-ethylphenoxy)-N-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]acetamide.
| Compound Name | 2-(4-ethylphenoxy)-N-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]acetamide |
|---|---|
| PubChem CID | 7972555 |
| Molecular Formula | C20H27N2O3+ |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 2-(4-ethylphenoxy)-N-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]acetamide |
| SMILES | CCc1ccc(OCC(=O)NC[C@@H](c2ccco2)[NH+]2CCCC2)cc1 |
| InChI | InChI=1S/C20H26N2O3/c1-2-16-7-9-17(10-8-16)25-15-20(23)21-14-18(19-6-5-13-24-19)22-11-3-4-12-22/h5-10,13,18H,2-4,11-12,14-15H2,1H3,(H,21,23)/p+1/t18-/m0/s1 |
| InChIKey | JVNLAQUJTFVCPW-SFHVURJKSA-O |
| XLogP | 1.76 |
| TPSA | 55.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |