C20H24BrN2O2+ — CID 8799066
2-(4-bromophenoxy)-N-[(2R)-2-phenyl-2-pyrrolidin-1-ium-1-ylethyl]acetamide (PubChem CID 8799066) has the molecular formula C20H24BrN2O2+ and a molecular weight of 404.33 g/mol. Its IUPAC name is 2-(4-bromophenoxy)-N-[(2R)-2-phenyl-2-pyrrolidin-1-ium-1-ylethyl]acetamide.
| Compound Name | 2-(4-bromophenoxy)-N-[(2R)-2-phenyl-2-pyrrolidin-1-ium-1-ylethyl]acetamide |
|---|---|
| PubChem CID | 8799066 |
| Molecular Formula | C20H24BrN2O2+ |
| Molecular Weight | 404.33 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 2-(4-bromophenoxy)-N-[(2R)-2-phenyl-2-pyrrolidin-1-ium-1-ylethyl]acetamide |
| SMILES | O=C(COc1ccc(Br)cc1)NC[C@@H](c1ccccc1)[NH+]1CCCC1 |
| InChI | InChI=1S/C20H23BrN2O2/c21-17-8-10-18(11-9-17)25-15-20(24)22-14-19(23-12-4-5-13-23)16-6-2-1-3-7-16/h1-3,6-11,19H,4-5,12-15H2,(H,22,24)/p+1/t19-/m0/s1 |
| InChIKey | CJUVHPDRJSEUJF-IBGZPJMESA-O |
| XLogP | 2.36 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |