C21H27N2O3S+ — CID 8799674
2-(4-propanoylphenoxy)-N-[(2R)-2-pyrrolidin-1-ium-1-yl-2-thiophen-2-ylethyl]acetamide (PubChem CID 8799674) has the molecular formula C21H27N2O3S+ and a molecular weight of 387.53 g/mol. Its IUPAC name is 2-(4-propanoylphenoxy)-N-[(2R)-2-pyrrolidin-1-ium-1-yl-2-thiophen-2-ylethyl]acetamide.
| Compound Name | 2-(4-propanoylphenoxy)-N-[(2R)-2-pyrrolidin-1-ium-1-yl-2-thiophen-2-ylethyl]acetamide |
|---|---|
| PubChem CID | 8799674 |
| Molecular Formula | C21H27N2O3S+ |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 2-(4-propanoylphenoxy)-N-[(2R)-2-pyrrolidin-1-ium-1-yl-2-thiophen-2-ylethyl]acetamide |
| SMILES | CCC(=O)c1ccc(OCC(=O)NC[C@H](c2cccs2)[NH+]2CCCC2)cc1 |
| InChI | InChI=1S/C21H26N2O3S/c1-2-19(24)16-7-9-17(10-8-16)26-15-21(25)22-14-18(20-6-5-13-27-20)23-11-3-4-12-23/h5-10,13,18H,2-4,11-12,14-15H2,1H3,(H,22,25)/p+1/t18-/m1/s1 |
| InChIKey | VOCNPSOFSKVYSZ-GOSISDBHSA-O |
| XLogP | 2.26 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |