C25H29N2O3+ — CID 7594382
N-[(2R)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ium-1-ylethyl]-2-naphthalen-2-yloxyacetamide (PubChem CID 7594382) has the molecular formula C25H29N2O3+ and a molecular weight of 405.52 g/mol. Its IUPAC name is N-[(2R)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ium-1-ylethyl]-2-naphthalen-2-yloxyacetamide.
| Compound Name | N-[(2R)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ium-1-ylethyl]-2-naphthalen-2-yloxyacetamide |
|---|---|
| PubChem CID | 7594382 |
| Molecular Formula | C25H29N2O3+ |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | N-[(2R)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ium-1-ylethyl]-2-naphthalen-2-yloxyacetamide |
| SMILES | COc1ccc([C@H](CNC(=O)COc2ccc3ccccc3c2)[NH+]2CCCC2)cc1 |
| InChI | InChI=1S/C25H28N2O3/c1-29-22-11-9-20(10-12-22)24(27-14-4-5-15-27)17-26-25(28)18-30-23-13-8-19-6-2-3-7-21(19)16-23/h2-3,6-13,16,24H,4-5,14-15,17-18H2,1H3,(H,26,28)/p+1/t24-/m0/s1 |
| InChIKey | ULHYPFSXGYVDGM-DEOSSOPVSA-O |
| XLogP | 2.76 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |