C24H29N3O2 — CID 43955991
N-[2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]-2-naphthalen-2-yloxyacetamide (PubChem CID 43955991) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]-2-naphthalen-2-yloxyacetamide.
| Compound Name | N-[2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]-2-naphthalen-2-yloxyacetamide |
|---|---|
| PubChem CID | 43955991 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | N-[2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]-2-naphthalen-2-yloxyacetamide |
| SMILES | CN(C)c1ccc(C(CNC(=O)COc2ccc3ccccc3c2)N(C)C)cc1 |
| InChI | InChI=1S/C24H29N3O2/c1-26(2)21-12-9-19(10-13-21)23(27(3)4)16-25-24(28)17-29-22-14-11-18-7-5-6-8-20(18)15-22/h5-15,23H,16-17H2,1-4H3,(H,25,28) |
| InChIKey | RDJITSQATMDVPU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|