C26H23NO3 — CID 95180836
N-[(S)-(4-methoxyphenyl)-phenylmethyl]-2-naphthalen-2-yloxyacetamide (PubChem CID 95180836) has the molecular formula C26H23NO3 and a molecular weight of 397.47 g/mol. Its IUPAC name is N-[(S)-(4-methoxyphenyl)-phenylmethyl]-2-naphthalen-2-yloxyacetamide.
| Compound Name | N-[(S)-(4-methoxyphenyl)-phenylmethyl]-2-naphthalen-2-yloxyacetamide |
|---|---|
| PubChem CID | 95180836 |
| Molecular Formula | C26H23NO3 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | N-[(S)-(4-methoxyphenyl)-phenylmethyl]-2-naphthalen-2-yloxyacetamide |
| SMILES | COc1ccc([C@@H](NC(=O)COc2ccc3ccccc3c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H23NO3/c1-29-23-14-12-21(13-15-23)26(20-8-3-2-4-9-20)27-25(28)18-30-24-16-11-19-7-5-6-10-22(19)17-24/h2-17,26H,18H2,1H3,(H,27,28)/t26-/m0/s1 |
| InChIKey | MJECFTLQGDBBAK-SANMLTNESA-N |
| XLogP | 5.13 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |