C23H23NO3 — CID 38020716
2-(4-methoxyphenoxy)-N-[(S)-(2-methylphenyl)-phenylmethyl]acetamide (PubChem CID 38020716) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)-N-[(S)-(2-methylphenyl)-phenylmethyl]acetamide.
| Compound Name | 2-(4-methoxyphenoxy)-N-[(S)-(2-methylphenyl)-phenylmethyl]acetamide |
|---|---|
| PubChem CID | 38020716 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 2-(4-methoxyphenoxy)-N-[(S)-(2-methylphenyl)-phenylmethyl]acetamide |
| SMILES | COc1ccc(OCC(=O)N[C@@H](c2ccccc2)c2ccccc2C)cc1 |
| InChI | InChI=1S/C23H23NO3/c1-17-8-6-7-11-21(17)23(18-9-4-3-5-10-18)24-22(25)16-27-20-14-12-19(26-2)13-15-20/h3-15,23H,16H2,1-2H3,(H,24,25)/t23-/m0/s1 |
| InChIKey | FHXICSZLSBJIDP-QHCPKHFHSA-N |
| XLogP | 4.29 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |