C19H25N2O4+ — CID 9404067
N-[(2R)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]-3,5-dimethoxybenzamide (PubChem CID 9404067) has the molecular formula C19H25N2O4+ and a molecular weight of 345.42 g/mol. Its IUPAC name is N-[(2R)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[(2R)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 9404067 |
| Molecular Formula | C19H25N2O4+ |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | N-[(2R)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NC[C@H](c2ccco2)[NH+]2CCCC2)c1 |
| InChI | InChI=1S/C19H24N2O4/c1-23-15-10-14(11-16(12-15)24-2)19(22)20-13-17(18-6-5-9-25-18)21-7-3-4-8-21/h5-6,9-12,17H,3-4,7-8,13H2,1-2H3,(H,20,22)/p+1/t17-/m1/s1 |
| InChIKey | YOEJWVHEWBMSQR-QGZVFWFLSA-O |
| XLogP | 1.45 |
| TPSA | 65.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |