C19H23F2N2O4S+ — CID 8501820
4-(difluoromethylsulfonyl)-N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]benzamide (PubChem CID 8501820) has the molecular formula C19H23F2N2O4S+ and a molecular weight of 413.47 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]benzamide.
| Compound Name | 4-(difluoromethylsulfonyl)-N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]benzamide |
|---|---|
| PubChem CID | 8501820 |
| Molecular Formula | C19H23F2N2O4S+ |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]benzamide |
| SMILES | O=C(NC[C@H](c1ccco1)[NH+]1CCCCC1)c1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C19H22F2N2O4S/c20-19(21)28(25,26)15-8-6-14(7-9-15)18(24)22-13-16(17-5-4-12-27-17)23-10-2-1-3-11-23/h4-9,12,16,19H,1-3,10-11,13H2,(H,22,24)/p+1/t16-/m1/s1 |
| InChIKey | ZFEPSOBNBHGBJP-MRXNPFEDSA-O |
| XLogP | 1.82 |
| TPSA | 80.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |