C14H13F2NO4S — CID 8856828
4-(difluoromethylsulfonyl)-N-[(1S)-1-(furan-2-yl)ethyl]benzamide (PubChem CID 8856828) has the molecular formula C14H13F2NO4S and a molecular weight of 329.32 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-[(1S)-1-(furan-2-yl)ethyl]benzamide.
| Compound Name | 4-(difluoromethylsulfonyl)-N-[(1S)-1-(furan-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 8856828 |
| Molecular Formula | C14H13F2NO4S |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-[(1S)-1-(furan-2-yl)ethyl]benzamide |
| SMILES | C[C@H](NC(=O)c1ccc(S(=O)(=O)C(F)F)cc1)c1ccco1 |
| InChI | InChI=1S/C14H13F2NO4S/c1-9(12-3-2-8-21-12)17-13(18)10-4-6-11(7-5-10)22(19,20)14(15)16/h2-9,14H,1H3,(H,17,18)/t9-/m0/s1 |
| InChIKey | AFPVZFACNMJHAG-VIFPVBQESA-N |
| XLogP | 2.77 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |