C16H13F4NO3S — CID 8795001
4-(difluoromethylsulfonyl)-N-[(1S)-1-(3,4-difluorophenyl)ethyl]benzamide (PubChem CID 8795001) has the molecular formula C16H13F4NO3S and a molecular weight of 375.34 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-[(1S)-1-(3,4-difluorophenyl)ethyl]benzamide.
| Compound Name | 4-(difluoromethylsulfonyl)-N-[(1S)-1-(3,4-difluorophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 8795001 |
| Molecular Formula | C16H13F4NO3S |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-[(1S)-1-(3,4-difluorophenyl)ethyl]benzamide |
| SMILES | C[C@H](NC(=O)c1ccc(S(=O)(=O)C(F)F)cc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H13F4NO3S/c1-9(11-4-7-13(17)14(18)8-11)21-15(22)10-2-5-12(6-3-10)25(23,24)16(19)20/h2-9,16H,1H3,(H,21,22)/t9-/m0/s1 |
| InChIKey | RXHMGSPXUSBMAK-VIFPVBQESA-N |
| XLogP | 3.45 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |