C16H14ClF2NO3S — CID 51150850
4-chloro-N-[1-(3,4-difluorophenyl)ethyl]-3-methylsulfonylbenzamide (PubChem CID 51150850) has the molecular formula C16H14ClF2NO3S and a molecular weight of 373.81 g/mol. Its IUPAC name is 4-chloro-N-[1-(3,4-difluorophenyl)ethyl]-3-methylsulfonylbenzamide.
| Compound Name | 4-chloro-N-[1-(3,4-difluorophenyl)ethyl]-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 51150850 |
| Molecular Formula | C16H14ClF2NO3S |
| Molecular Weight | 373.81 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 4-chloro-N-[1-(3,4-difluorophenyl)ethyl]-3-methylsulfonylbenzamide |
| SMILES | CC(NC(=O)c1ccc(Cl)c(S(C)(=O)=O)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H14ClF2NO3S/c1-9(10-4-6-13(18)14(19)7-10)20-16(21)11-3-5-12(17)15(8-11)24(2,22)23/h3-9H,1-2H3,(H,20,21) |
| InChIKey | IQVFNOPOBZAQNJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.81 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |