C18H21FN2O5S2 — CID 55792937
3-(dimethylsulfamoyl)-4-fluoro-N-[1-(4-methylsulfonylphenyl)ethyl]benzamide (PubChem CID 55792937) has the molecular formula C18H21FN2O5S2 and a molecular weight of 428.51 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-4-fluoro-N-[1-(4-methylsulfonylphenyl)ethyl]benzamide.
| Compound Name | 3-(dimethylsulfamoyl)-4-fluoro-N-[1-(4-methylsulfonylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 55792937 |
| Molecular Formula | C18H21FN2O5S2 |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 3-(dimethylsulfamoyl)-4-fluoro-N-[1-(4-methylsulfonylphenyl)ethyl]benzamide |
| SMILES | CC(NC(=O)c1ccc(F)c(S(=O)(=O)N(C)C)c1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H21FN2O5S2/c1-12(13-5-8-15(9-6-13)27(4,23)24)20-18(22)14-7-10-16(19)17(11-14)28(25,26)21(2)3/h5-12H,1-4H3,(H,20,22) |
| InChIKey | NJVKIUADNDWGAN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |