C19H25N2O4S+ — CID 2481597
N-[(2S)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]-4-methylsulfonylbenzamide (PubChem CID 2481597) has the molecular formula C19H25N2O4S+ and a molecular weight of 377.49 g/mol. Its IUPAC name is N-[(2S)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]-4-methylsulfonylbenzamide.
| Compound Name | N-[(2S)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 2481597 |
| Molecular Formula | C19H25N2O4S+ |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | N-[(2S)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]-4-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)NC[C@@H](c2ccco2)[NH+]2CCCCC2)cc1 |
| InChI | InChI=1S/C19H24N2O4S/c1-26(23,24)16-9-7-15(8-10-16)19(22)20-14-17(18-6-5-13-25-18)21-11-3-2-4-12-21/h5-10,13,17H,2-4,11-12,14H2,1H3,(H,20,22)/p+1/t17-/m0/s1 |
| InChIKey | RYOZNPDHKUDYOK-KRWDZBQOSA-O |
| XLogP | 1.22 |
| TPSA | 80.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |