C22H27N4O4+ — CID 2558900
1-ethyl-N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]-2,3-dioxo-4H-quinoxaline-6-carboxamide (PubChem CID 2558900) has the molecular formula C22H27N4O4+ and a molecular weight of 411.48 g/mol. Its IUPAC name is 1-ethyl-N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]-2,3-dioxo-4H-quinoxaline-6-carboxamide.
| Compound Name | 1-ethyl-N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]-2,3-dioxo-4H-quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 2558900 |
| Molecular Formula | C22H27N4O4+ |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 1-ethyl-N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]-2,3-dioxo-4H-quinoxaline-6-carboxamide |
| SMILES | CCn1c(=O)c(=O)[nH]c2cc(C(=O)NC[C@H](c3ccco3)[NH+]3CCCCC3)ccc21 |
| InChI | InChI=1S/C22H26N4O4/c1-2-26-17-9-8-15(13-16(17)24-21(28)22(26)29)20(27)23-14-18(19-7-6-12-30-19)25-10-4-3-5-11-25/h6-9,12-13,18H,2-5,10-11,14H2,1H3,(H,23,27)(H,24,28)/p+1/t18-/m1/s1 |
| InChIKey | JCMQFEQMJVDLDG-GOSISDBHSA-O |
| XLogP | 0.84 |
| TPSA | 101.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|