C20H22N3O3+ — CID 9291963
N-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]-2-oxo-1H-quinoline-4-carboxamide (PubChem CID 9291963) has the molecular formula C20H22N3O3+ and a molecular weight of 352.41 g/mol. Its IUPAC name is N-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]-2-oxo-1H-quinoline-4-carboxamide.
| Compound Name | N-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]-2-oxo-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 9291963 |
| Molecular Formula | C20H22N3O3+ |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | N-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]-2-oxo-1H-quinoline-4-carboxamide |
| SMILES | O=C(NC[C@@H](c1ccco1)[NH+]1CCCC1)c1cc(=O)[nH]c2ccccc12 |
| InChI | InChI=1S/C20H21N3O3/c24-19-12-15(14-6-1-2-7-16(14)22-19)20(25)21-13-17(18-8-5-11-26-18)23-9-3-4-10-23/h1-2,5-8,11-12,17H,3-4,9-10,13H2,(H,21,25)(H,22,24)/p+1/t17-/m0/s1 |
| InChIKey | RXBMNVXOCZQDEE-KRWDZBQOSA-O |
| XLogP | 1.27 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |