C21H23N3O3 — CID 2542030
N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-oxo-1H-quinoline-4-carboxamide (PubChem CID 2542030) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-oxo-1H-quinoline-4-carboxamide.
| Compound Name | N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-oxo-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 2542030 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-oxo-1H-quinoline-4-carboxamide |
| SMILES | O=C(NC[C@H](c1ccco1)N1CCCCC1)c1cc(=O)[nH]c2ccccc12 |
| InChI | InChI=1S/C21H23N3O3/c25-20-13-16(15-7-2-3-8-17(15)23-20)21(26)22-14-18(19-9-6-12-27-19)24-10-4-1-5-11-24/h2-3,6-9,12-13,18H,1,4-5,10-11,14H2,(H,22,26)(H,23,25)/t18-/m1/s1 |
| InChIKey | XMAMJSKOJMHDCU-GOSISDBHSA-N |
| XLogP | 3.08 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |