C23H33N2O5+ — CID 7972668
3,4,5-triethoxy-N-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]benzamide (PubChem CID 7972668) has the molecular formula C23H33N2O5+ and a molecular weight of 417.53 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]benzamide |
|---|---|
| PubChem CID | 7972668 |
| Molecular Formula | C23H33N2O5+ |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 3,4,5-triethoxy-N-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]benzamide |
| SMILES | CCOc1cc(C(=O)NC[C@@H](c2ccco2)[NH+]2CCCC2)cc(OCC)c1OCC |
| InChI | InChI=1S/C23H32N2O5/c1-4-27-20-14-17(15-21(28-5-2)22(20)29-6-3)23(26)24-16-18(19-10-9-13-30-19)25-11-7-8-12-25/h9-10,13-15,18H,4-8,11-12,16H2,1-3H3,(H,24,26)/p+1/t18-/m0/s1 |
| InChIKey | UFVNNDLESYOKEN-SFHVURJKSA-O |
| XLogP | 2.63 |
| TPSA | 74.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |