C20H28N3O4S+ — CID 7719508
4-(dimethylsulfamoyl)-N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]benzamide (PubChem CID 7719508) has the molecular formula C20H28N3O4S+ and a molecular weight of 406.53 g/mol. Its IUPAC name is 4-(dimethylsulfamoyl)-N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]benzamide.
| Compound Name | 4-(dimethylsulfamoyl)-N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]benzamide |
|---|---|
| PubChem CID | 7719508 |
| Molecular Formula | C20H28N3O4S+ |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 4-(dimethylsulfamoyl)-N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]benzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)NC[C@H](c2ccco2)[NH+]2CCCCC2)cc1 |
| InChI | InChI=1S/C20H27N3O4S/c1-22(2)28(25,26)17-10-8-16(9-11-17)20(24)21-15-18(19-7-6-14-27-19)23-12-4-3-5-13-23/h6-11,14,18H,3-5,12-13,15H2,1-2H3,(H,21,24)/p+1/t18-/m1/s1 |
| InChIKey | JPOSMSMEYIHZHI-GOSISDBHSA-O |
| XLogP | 1.07 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |