C20H25N2O3+ — CID 7780297
(E)-N-[(2R)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]-3-(4-methoxyphenyl)prop-2-enamide (PubChem CID 7780297) has the molecular formula C20H25N2O3+ and a molecular weight of 341.43 g/mol. Its IUPAC name is (E)-N-[(2R)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]-3-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(2R)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]-3-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 7780297 |
| Molecular Formula | C20H25N2O3+ |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | (E)-N-[(2R)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]-3-(4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NC[C@H](c2ccco2)[NH+]2CCCC2)cc1 |
| InChI | InChI=1S/C20H24N2O3/c1-24-17-9-6-16(7-10-17)8-11-20(23)21-15-18(19-5-4-14-25-19)22-12-2-3-13-22/h4-11,14,18H,2-3,12-13,15H2,1H3,(H,21,23)/p+1/b11-8+/t18-/m1/s1 |
| InChIKey | RJGZNMIDMITMDF-VEGGFIAOSA-O |
| XLogP | 1.84 |
| TPSA | 55.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|