C21H29N2O3+ — CID 2468273
N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]-3-(3-methylphenoxy)propanamide (PubChem CID 2468273) has the molecular formula C21H29N2O3+ and a molecular weight of 357.47 g/mol. Its IUPAC name is N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]-3-(3-methylphenoxy)propanamide.
| Compound Name | N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]-3-(3-methylphenoxy)propanamide |
|---|---|
| PubChem CID | 2468273 |
| Molecular Formula | C21H29N2O3+ |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]-3-(3-methylphenoxy)propanamide |
| SMILES | Cc1cccc(OCCC(=O)NC[C@H](c2ccco2)[NH+]2CCCCC2)c1 |
| InChI | InChI=1S/C21H28N2O3/c1-17-7-5-8-18(15-17)25-14-10-21(24)22-16-19(20-9-6-13-26-20)23-11-3-2-4-12-23/h5-9,13,15,19H,2-4,10-12,14,16H2,1H3,(H,22,24)/p+1/t19-/m1/s1 |
| InChIKey | YKPVJEFRIBUFFX-LJQANCHMSA-O |
| XLogP | 2.28 |
| TPSA | 55.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |