C17H15NO2S — CID 100724295
N-[(2R)-2-(1-benzothiophen-3-yl)-2-hydroxyethyl]benzamide (PubChem CID 100724295) has the molecular formula C17H15NO2S and a molecular weight of 297.38 g/mol. Its IUPAC name is N-[(2R)-2-(1-benzothiophen-3-yl)-2-hydroxyethyl]benzamide.
| Compound Name | N-[(2R)-2-(1-benzothiophen-3-yl)-2-hydroxyethyl]benzamide |
|---|---|
| PubChem CID | 100724295 |
| Molecular Formula | C17H15NO2S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | N-[(2R)-2-(1-benzothiophen-3-yl)-2-hydroxyethyl]benzamide |
| SMILES | O=C(NC[C@H](O)c1csc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C17H15NO2S/c19-15(10-18-17(20)12-6-2-1-3-7-12)14-11-21-16-9-5-4-8-13(14)16/h1-9,11,15,19H,10H2,(H,18,20)/t15-/m0/s1 |
| InChIKey | HJPHGKGLZGHSHC-HNNXBMFYSA-N |
| XLogP | 3.36 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |