C23H19NO3S — CID 121179463
N-[2-(1-benzothiophen-3-yl)-2-hydroxyethyl]-4-phenoxybenzamide (PubChem CID 121179463) has the molecular formula C23H19NO3S and a molecular weight of 389.48 g/mol. Its IUPAC name is N-[2-(1-benzothiophen-3-yl)-2-hydroxyethyl]-4-phenoxybenzamide.
| Compound Name | N-[2-(1-benzothiophen-3-yl)-2-hydroxyethyl]-4-phenoxybenzamide |
|---|---|
| PubChem CID | 121179463 |
| Molecular Formula | C23H19NO3S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | N-[2-(1-benzothiophen-3-yl)-2-hydroxyethyl]-4-phenoxybenzamide |
| SMILES | O=C(NCC(O)c1csc2ccccc12)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C23H19NO3S/c25-21(20-15-28-22-9-5-4-8-19(20)22)14-24-23(26)16-10-12-18(13-11-16)27-17-6-2-1-3-7-17/h1-13,15,21,25H,14H2,(H,24,26) |
| InChIKey | OQXHSLQXXLMTIQ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |