C19H22ClFN2O — CID 69054072
1-(4-chlorophenyl)-2-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]ethanol (PubChem CID 69054072) has the molecular formula C19H22ClFN2O and a molecular weight of 348.85 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]ethanol.
| Compound Name | 1-(4-chlorophenyl)-2-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 69054072 |
| Molecular Formula | C19H22ClFN2O |
| Molecular Weight | 348.85 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 1-(4-chlorophenyl)-2-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]ethanol |
| SMILES | OC(CN1CCN(Cc2ccc(F)cc2)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H22ClFN2O/c20-17-5-3-16(4-6-17)19(24)14-23-11-9-22(10-12-23)13-15-1-7-18(21)8-2-15/h1-8,19,24H,9-14H2 |
| InChIKey | WIRCEDSHCAKCBL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.85 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |